C17H22N2OS — CID 80740009
5-propoxy-3-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzene-1,3-diamine (PubChem CID 80740009) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 5-propoxy-3-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzene-1,3-diamine.
| Compound Name | 5-propoxy-3-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80740009 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-propoxy-3-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NC2CCCc3sccc32)c1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-7-20-14-10-12(18)9-13(11-14)19-16-4-3-5-17-15(16)6-8-21-17/h6,8-11,16,19H,2-5,7,18H2,1H3 |
| InChIKey | CSEITYKWDJHVIR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|