C17H20BrNOS — CID 82010961
2-bromo-N-(4-propoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82010961) has the molecular formula C17H20BrNOS and a molecular weight of 366.32 g/mol. Its IUPAC name is 2-bromo-N-(4-propoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-(4-propoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82010961 |
| Molecular Formula | C17H20BrNOS |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 2-bromo-N-(4-propoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CCCOc1ccc(NC2CCCc3sc(Br)cc32)cc1 |
| InChI | InChI=1S/C17H20BrNOS/c1-2-10-20-13-8-6-12(7-9-13)19-15-4-3-5-16-14(15)11-17(18)21-16/h6-9,11,15,19H,2-5,10H2,1H3 |
| InChIKey | HMKNOSBTMCHVAE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|