C16H17BrClNOS — CID 82012021
2-bromo-N-(3-chloro-4-ethoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 82012021) has the molecular formula C16H17BrClNOS and a molecular weight of 386.74 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-4-ethoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | 2-bromo-N-(3-chloro-4-ethoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 82012021 |
| Molecular Formula | C16H17BrClNOS |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 2-bromo-N-(3-chloro-4-ethoxyphenyl)-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | CCOc1ccc(NC2CCCc3sc(Br)cc32)cc1Cl |
| InChI | InChI=1S/C16H17BrClNOS/c1-2-20-14-7-6-10(8-12(14)18)19-13-4-3-5-15-11(13)9-16(17)21-15/h6-9,13,19H,2-5H2,1H3 |
| InChIKey | SKLYEPOTCQSSDK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|