C14H11NO3S2 — CID 80740313
2-(2-nitrophenyl)-1-thieno[3,2-b]thiophen-5-ylethanol (PubChem CID 80740313) has the molecular formula C14H11NO3S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-1-thieno[3,2-b]thiophen-5-ylethanol.
| Compound Name | 2-(2-nitrophenyl)-1-thieno[3,2-b]thiophen-5-ylethanol |
|---|---|
| PubChem CID | 80740313 |
| Molecular Formula | C14H11NO3S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-(2-nitrophenyl)-1-thieno[3,2-b]thiophen-5-ylethanol |
| SMILES | O=[N+]([O-])c1ccccc1CC(O)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H11NO3S2/c16-11(13-8-14-12(20-13)5-6-19-14)7-9-3-1-2-4-10(9)15(17)18/h1-6,8,11,16H,7H2 |
| InChIKey | MJLOPHOUGOZQDV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|