C13H16N2OS2 — CID 80745714
N-ethyl-N-pyrrolidin-3-ylthieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80745714) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N-ethyl-N-pyrrolidin-3-ylthieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-ethyl-N-pyrrolidin-3-ylthieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80745714 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-ethyl-N-pyrrolidin-3-ylthieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CCN(C(=O)c1cc2sccc2s1)C1CCNC1 |
| InChI | InChI=1S/C13H16N2OS2/c1-2-15(9-3-5-14-8-9)13(16)12-7-11-10(18-12)4-6-17-11/h4,6-7,9,14H,2-3,5,8H2,1H3 |
| InChIKey | XGHRMCUUGKGNNF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |