C12H15N3O2S2 — CID 80745942
N-[(2Z)-2-amino-2-hydroxyiminoethyl]-N-propylthieno[3,2-b]thiophene-5-carboxamide (PubChem CID 80745942) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydroxyiminoethyl]-N-propylthieno[3,2-b]thiophene-5-carboxamide.
| Compound Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-N-propylthieno[3,2-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 80745942 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-N-propylthieno[3,2-b]thiophene-5-carboxamide |
| SMILES | CCCN(C/C(N)=N/O)C(=O)c1cc2sccc2s1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-2-4-15(7-11(13)14-17)12(16)10-6-9-8(19-10)3-5-18-9/h3,5-6,17H,2,4,7H2,1H3,(H2,13,14) |
| InChIKey | PLLBJEUFTFDJHS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|