C14H15FN2O2 — CID 80746568
6-[cyclopentyl(methyl)amino]-5-fluoro-1H-indole-2,3-dione (PubChem CID 80746568) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is 6-[cyclopentyl(methyl)amino]-5-fluoro-1H-indole-2,3-dione.
| Compound Name | 6-[cyclopentyl(methyl)amino]-5-fluoro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 80746568 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 6-[cyclopentyl(methyl)amino]-5-fluoro-1H-indole-2,3-dione |
| SMILES | CN(c1cc2c(cc1F)C(=O)C(=O)N2)C1CCCC1 |
| InChI | InChI=1S/C14H15FN2O2/c1-17(8-4-2-3-5-8)12-7-11-9(6-10(12)15)13(18)14(19)16-11/h6-8H,2-5H2,1H3,(H,16,18,19) |
| InChIKey | VZWINMXECLYRGV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|