C15H15FN2O2 — CID 80746677
6-[cyclopropyl(cyclopropylmethyl)amino]-5-fluoro-1H-indole-2,3-dione (PubChem CID 80746677) has the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. Its IUPAC name is 6-[cyclopropyl(cyclopropylmethyl)amino]-5-fluoro-1H-indole-2,3-dione.
| Compound Name | 6-[cyclopropyl(cyclopropylmethyl)amino]-5-fluoro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 80746677 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 6-[cyclopropyl(cyclopropylmethyl)amino]-5-fluoro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(N(CC3CC3)C3CC3)c(F)cc2C1=O |
| InChI | InChI=1S/C15H15FN2O2/c16-11-5-10-12(17-15(20)14(10)19)6-13(11)18(9-3-4-9)7-8-1-2-8/h5-6,8-9H,1-4,7H2,(H,17,19,20) |
| InChIKey | FFCMMBWJUCBDAY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|