C14H6F3NO2S — CID 80746944
6-(2,4-difluorophenyl)sulfanyl-5-fluoro-1H-indole-2,3-dione (PubChem CID 80746944) has the molecular formula C14H6F3NO2S and a molecular weight of 309.27 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)sulfanyl-5-fluoro-1H-indole-2,3-dione.
| Compound Name | 6-(2,4-difluorophenyl)sulfanyl-5-fluoro-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 80746944 |
| Molecular Formula | C14H6F3NO2S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 6-(2,4-difluorophenyl)sulfanyl-5-fluoro-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(Sc3ccc(F)cc3F)c(F)cc2C1=O |
| InChI | InChI=1S/C14H6F3NO2S/c15-6-1-2-11(8(16)3-6)21-12-5-10-7(4-9(12)17)13(19)14(20)18-10/h1-5H,(H,18,19,20) |
| InChIKey | PPFUXXVIZBENPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|