C12H12F3N5O — CID 80748779
6-propoxy-2-N-(2,3,4-trifluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80748779) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is 6-propoxy-2-N-(2,3,4-trifluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-propoxy-2-N-(2,3,4-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80748779 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 6-propoxy-2-N-(2,3,4-trifluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCOc1nc(N)nc(Nc2ccc(F)c(F)c2F)n1 |
| InChI | InChI=1S/C12H12F3N5O/c1-2-5-21-12-19-10(16)18-11(20-12)17-7-4-3-6(13)8(14)9(7)15/h3-4H,2,5H2,1H3,(H3,16,17,18,19,20) |
| InChIKey | STOTYRSKSBOSBA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|