C9H8F4N2O2 — CID 80753032
3-fluoro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 80753032) has the molecular formula C9H8F4N2O2 and a molecular weight of 252.17 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 3-fluoro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 80753032 |
| Molecular Formula | C9H8F4N2O2 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-fluoro-N-methyl-5-nitro-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CN(CC(F)(F)F)c1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H8F4N2O2/c1-14(5-9(11,12)13)7-2-6(10)3-8(4-7)15(16)17/h2-4H,5H2,1H3 |
| InChIKey | BBOKWYQFMXPBIG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|