C13H19FN2O2 — CID 80751734
N-(3,3-dimethylbutan-2-yl)-3-fluoro-N-methyl-5-nitroaniline (PubChem CID 80751734) has the molecular formula C13H19FN2O2 and a molecular weight of 254.30 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-3-fluoro-N-methyl-5-nitroaniline.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-3-fluoro-N-methyl-5-nitroaniline |
|---|---|
| PubChem CID | 80751734 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-3-fluoro-N-methyl-5-nitroaniline |
| SMILES | CC(N(C)c1cc(F)cc([N+](=O)[O-])c1)C(C)(C)C |
| InChI | InChI=1S/C13H19FN2O2/c1-9(13(2,3)4)15(5)11-6-10(14)7-12(8-11)16(17)18/h6-9H,1-5H3 |
| InChIKey | OSZMMRNGGXLDNE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|