C12H19N3O2 — CID 80776508
3-N-butan-2-yl-1-N,3-N-dimethyl-5-nitrobenzene-1,3-diamine (PubChem CID 80776508) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-N-butan-2-yl-1-N,3-N-dimethyl-5-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-butan-2-yl-1-N,3-N-dimethyl-5-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 80776508 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-N-butan-2-yl-1-N,3-N-dimethyl-5-nitrobenzene-1,3-diamine |
| SMILES | CCC(C)N(C)c1cc(NC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H19N3O2/c1-5-9(2)14(4)11-6-10(13-3)7-12(8-11)15(16)17/h6-9,13H,5H2,1-4H3 |
| InChIKey | AXOIHVMDEUDUHY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|