C13H21N3O2 — CID 80784506
1-N,3-N-dimethyl-5-nitro-3-N-pentylbenzene-1,3-diamine (PubChem CID 80784506) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-N,3-N-dimethyl-5-nitro-3-N-pentylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-dimethyl-5-nitro-3-N-pentylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 80784506 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-N,3-N-dimethyl-5-nitro-3-N-pentylbenzene-1,3-diamine |
| SMILES | CCCCCN(C)c1cc(NC)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H21N3O2/c1-4-5-6-7-15(3)12-8-11(14-2)9-13(10-12)16(17)18/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | CXCUNOJSERQRIG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|