C13H19FN6 — CID 80753931
5-fluoro-4-N-(3-imidazol-1-ylpropyl)-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80753931) has the molecular formula C13H19FN6 and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-fluoro-4-N-(3-imidazol-1-ylpropyl)-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-4-N-(3-imidazol-1-ylpropyl)-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80753931 |
| Molecular Formula | C13H19FN6 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5-fluoro-4-N-(3-imidazol-1-ylpropyl)-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(F)c(NCCCn2ccnc2)n1 |
| InChI | InChI=1S/C13H19FN6/c1-2-4-17-13-18-9-11(14)12(19-13)16-5-3-7-20-8-6-15-10-20/h6,8-10H,2-5,7H2,1H3,(H2,16,17,18,19) |
| InChIKey | HSRZYIBUDPLJMS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|