C12H22N4 — CID 80754266
4-N-butyl-4-N,5-diethylpyrimidine-4,6-diamine (PubChem CID 80754266) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-N-butyl-4-N,5-diethylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-4-N,5-diethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80754266 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-N-butyl-4-N,5-diethylpyrimidine-4,6-diamine |
| SMILES | CCCCN(CC)c1ncnc(N)c1CC |
| InChI | InChI=1S/C12H22N4/c1-4-7-8-16(6-3)12-10(5-2)11(13)14-9-15-12/h9H,4-8H2,1-3H3,(H2,13,14,15) |
| InChIKey | VKIQIVCBEZPLAS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |