C12H21N3 — CID 80754350
6-N-butyl-6-N-ethyl-2-N-methylpyridine-2,6-diamine (PubChem CID 80754350) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 6-N-butyl-6-N-ethyl-2-N-methylpyridine-2,6-diamine.
| Compound Name | 6-N-butyl-6-N-ethyl-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80754350 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 6-N-butyl-6-N-ethyl-2-N-methylpyridine-2,6-diamine |
| SMILES | CCCCN(CC)c1cccc(NC)n1 |
| InChI | InChI=1S/C12H21N3/c1-4-6-10-15(5-2)12-9-7-8-11(13-3)14-12/h7-9H,4-6,10H2,1-3H3,(H,13,14) |
| InChIKey | PYZIPOOTXUOTNN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |