C12H21N3O2 — CID 80795235
6-N,6-N-bis(2-methoxyethyl)-2-N-methylpyridine-2,6-diamine (PubChem CID 80795235) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 6-N,6-N-bis(2-methoxyethyl)-2-N-methylpyridine-2,6-diamine.
| Compound Name | 6-N,6-N-bis(2-methoxyethyl)-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80795235 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 6-N,6-N-bis(2-methoxyethyl)-2-N-methylpyridine-2,6-diamine |
| SMILES | CNc1cccc(N(CCOC)CCOC)n1 |
| InChI | InChI=1S/C12H21N3O2/c1-13-11-5-4-6-12(14-11)15(7-9-16-2)8-10-17-3/h4-6H,7-10H2,1-3H3,(H,13,14) |
| InChIKey | QOSGOQOYYJOHMZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |