C13H23N3O2 — CID 80796516
2-N-ethyl-6-N,6-N-bis(2-methoxyethyl)pyridine-2,6-diamine (PubChem CID 80796516) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-N-ethyl-6-N,6-N-bis(2-methoxyethyl)pyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N,6-N-bis(2-methoxyethyl)pyridine-2,6-diamine |
|---|---|
| PubChem CID | 80796516 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 2-N-ethyl-6-N,6-N-bis(2-methoxyethyl)pyridine-2,6-diamine |
| SMILES | CCNc1cccc(N(CCOC)CCOC)n1 |
| InChI | InChI=1S/C13H23N3O2/c1-4-14-12-6-5-7-13(15-12)16(8-10-17-2)9-11-18-3/h5-7H,4,8-11H2,1-3H3,(H,14,15) |
| InChIKey | BNPMVLKQKLSACE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |