C12H21N3O — CID 80823032
2-N-ethyl-6-N-(3-methoxypropyl)-6-N-methylpyridine-2,6-diamine (PubChem CID 80823032) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-N-ethyl-6-N-(3-methoxypropyl)-6-N-methylpyridine-2,6-diamine.
| Compound Name | 2-N-ethyl-6-N-(3-methoxypropyl)-6-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80823032 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-N-ethyl-6-N-(3-methoxypropyl)-6-N-methylpyridine-2,6-diamine |
| SMILES | CCNc1cccc(N(C)CCCOC)n1 |
| InChI | InChI=1S/C12H21N3O/c1-4-13-11-7-5-8-12(14-11)15(2)9-6-10-16-3/h5,7-8H,4,6,9-10H2,1-3H3,(H,13,14) |
| InChIKey | IHZVYOBVULCOQD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|