C10H13N3O4 — CID 80755851
(2R)-3-hydroxy-2-[(2-methyl-3-pyridinyl)carbamoylamino]propanoic acid (PubChem CID 80755851) has the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[(2-methyl-3-pyridinyl)carbamoylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[(2-methyl-3-pyridinyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 80755851 |
| Molecular Formula | C10H13N3O4 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (2R)-3-hydroxy-2-[(2-methyl-3-pyridinyl)carbamoylamino]propanoic acid |
| SMILES | Cc1ncccc1NC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C10H13N3O4/c1-6-7(3-2-4-11-6)12-10(17)13-8(5-14)9(15)16/h2-4,8,14H,5H2,1H3,(H,15,16)(H2,12,13,17)/t8-/m1/s1 |
| InChIKey | CFLZSQKMAHKKBJ-MRVPVSSYSA-N |
| XLogP | -0.04 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |