C11H7FN4O3S — CID 80758922
5-fluoro-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1H-indole-2,3-dione (PubChem CID 80758922) has the molecular formula C11H7FN4O3S and a molecular weight of 294.27 g/mol. Its IUPAC name is 5-fluoro-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1H-indole-2,3-dione.
| Compound Name | 5-fluoro-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 80758922 |
| Molecular Formula | C11H7FN4O3S |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 5-fluoro-6-[(4-methyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-1H-indole-2,3-dione |
| SMILES | Cn1c(Sc2cc3c(cc2F)C(=O)C(=O)N3)n[nH]c1=O |
| InChI | InChI=1S/C11H7FN4O3S/c1-16-10(19)14-15-11(16)20-7-3-6-4(2-5(7)12)8(17)9(18)13-6/h2-3H,1H3,(H,14,19)(H,13,17,18) |
| InChIKey | FTYYVTJNICJHON-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|