C13H16IN5O — CID 80763052
2-N-(2-iodophenyl)-4-N-methyl-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine (PubChem CID 80763052) has the molecular formula C13H16IN5O and a molecular weight of 385.21 g/mol. Its IUPAC name is 2-N-(2-iodophenyl)-4-N-methyl-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-iodophenyl)-4-N-methyl-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80763052 |
| Molecular Formula | C13H16IN5O |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 2-N-(2-iodophenyl)-4-N-methyl-6-propan-2-yloxy-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2I)nc(OC(C)C)n1 |
| InChI | InChI=1S/C13H16IN5O/c1-8(2)20-13-18-11(15-3)17-12(19-13)16-10-7-5-4-6-9(10)14/h4-8H,1-3H3,(H2,15,16,17,18,19) |
| InChIKey | JDUNIOZWZILETB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|