C14H17IN6 — CID 80737478
2-N-(2-iodophenyl)-4-N-methyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80737478) has the molecular formula C14H17IN6 and a molecular weight of 396.24 g/mol. Its IUPAC name is 2-N-(2-iodophenyl)-4-N-methyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-iodophenyl)-4-N-methyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80737478 |
| Molecular Formula | C14H17IN6 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-N-(2-iodophenyl)-4-N-methyl-6-pyrrolidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(Nc2ccccc2I)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H17IN6/c1-16-12-18-13(17-11-7-3-2-6-10(11)15)20-14(19-12)21-8-4-5-9-21/h2-3,6-7H,4-5,8-9H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | OXUYRYQFRLERME-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|