C11H11IN4 — CID 80763536
4-N-(2-iodophenyl)-6-N-methylpyrimidine-4,6-diamine (PubChem CID 80763536) has the molecular formula C11H11IN4 and a molecular weight of 326.14 g/mol. Its IUPAC name is 4-N-(2-iodophenyl)-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-iodophenyl)-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80763536 |
| Molecular Formula | C11H11IN4 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 4-N-(2-iodophenyl)-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2ccccc2I)ncn1 |
| InChI | InChI=1S/C11H11IN4/c1-13-10-6-11(15-7-14-10)16-9-5-3-2-4-8(9)12/h2-7H,1H3,(H2,13,14,15,16) |
| InChIKey | RVWWIVRVCSBGLZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|