C11H16BrN5O — CID 80765748
1-[5-bromo-2-(ethylamino)pyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 80765748) has the molecular formula C11H16BrN5O and a molecular weight of 314.19 g/mol. Its IUPAC name is 1-[5-bromo-2-(ethylamino)pyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[5-bromo-2-(ethylamino)pyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 80765748 |
| Molecular Formula | C11H16BrN5O |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 1-[5-bromo-2-(ethylamino)pyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | CCNc1ncc(Br)c(N2CCCC2C(N)=O)n1 |
| InChI | InChI=1S/C11H16BrN5O/c1-2-14-11-15-6-7(12)10(16-11)17-5-3-4-8(17)9(13)18/h6,8H,2-5H2,1H3,(H2,13,18)(H,14,15,16) |
| InChIKey | VOXIEJLUPNFGEG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |