C13H21N5O — CID 80756566
1-[2-(ethylamino)-5-methylpyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 80756566) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-(ethylamino)-5-methylpyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(ethylamino)-5-methylpyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 80756566 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-[2-(ethylamino)-5-methylpyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | CCNc1ncc(C)c(N2CCCC(C(N)=O)C2)n1 |
| InChI | InChI=1S/C13H21N5O/c1-3-15-13-16-7-9(2)12(17-13)18-6-4-5-10(8-18)11(14)19/h7,10H,3-6,8H2,1-2H3,(H2,14,19)(H,15,16,17) |
| InChIKey | UBRAFWGPOXWPIC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |