C11H20N4O — CID 80771706
2-[[5-ethyl-6-(ethylamino)pyrimidin-4-yl]-methylamino]ethanol (PubChem CID 80771706) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-[[5-ethyl-6-(ethylamino)pyrimidin-4-yl]-methylamino]ethanol.
| Compound Name | 2-[[5-ethyl-6-(ethylamino)pyrimidin-4-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 80771706 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-[[5-ethyl-6-(ethylamino)pyrimidin-4-yl]-methylamino]ethanol |
| SMILES | CCNc1ncnc(N(C)CCO)c1CC |
| InChI | InChI=1S/C11H20N4O/c1-4-9-10(12-5-2)13-8-14-11(9)15(3)6-7-16/h8,16H,4-7H2,1-3H3,(H,12,13,14) |
| InChIKey | RMRLYYWSGXQDDP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |