C11H22N6 — CID 80909904
N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 80909904) has the molecular formula C11H22N6 and a molecular weight of 238.34 g/mol. Its IUPAC name is N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 80909904 |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCc1c(NN)ncnc1N(C)CCN(C)C |
| InChI | InChI=1S/C11H22N6/c1-5-9-10(15-12)13-8-14-11(9)17(4)7-6-16(2)3/h8H,5-7,12H2,1-4H3,(H,13,14,15) |
| InChIKey | PVEGKWLBBRHQHL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|