C14H28N6 — CID 80901167
N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 80901167) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 80901167 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | N'-(5-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CCc1c(NN)ncnc1N(CCN(C)C)CC(C)C |
| InChI | InChI=1S/C14H28N6/c1-6-12-13(18-15)16-10-17-14(12)20(9-11(2)3)8-7-19(4)5/h10-11H,6-9,15H2,1-5H3,(H,16,17,18) |
| InChIKey | GNADVCFJGPJNTL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|