C11H18F3N5 — CID 80901339
5-ethyl-6-hydrazinyl-N-propyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 80901339) has the molecular formula C11H18F3N5 and a molecular weight of 277.29 g/mol. Its IUPAC name is 5-ethyl-6-hydrazinyl-N-propyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-6-hydrazinyl-N-propyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80901339 |
| Molecular Formula | C11H18F3N5 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5-ethyl-6-hydrazinyl-N-propyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CCCN(CC(F)(F)F)c1ncnc(NN)c1CC |
| InChI | InChI=1S/C11H18F3N5/c1-3-5-19(6-11(12,13)14)10-8(4-2)9(18-15)16-7-17-10/h7H,3-6,15H2,1-2H3,(H,16,17,18) |
| InChIKey | IJXLCPQQFJRRII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|