C12H16N6O — CID 80773060
6-propoxy-2-N-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80773060) has the molecular formula C12H16N6O and a molecular weight of 260.30 g/mol. Its IUPAC name is 6-propoxy-2-N-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-propoxy-2-N-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80773060 |
| Molecular Formula | C12H16N6O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 6-propoxy-2-N-(pyridin-3-ylmethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCOc1nc(N)nc(NCc2cccnc2)n1 |
| InChI | InChI=1S/C12H16N6O/c1-2-6-19-12-17-10(13)16-11(18-12)15-8-9-4-3-5-14-7-9/h3-5,7H,2,6,8H2,1H3,(H3,13,15,16,17,18) |
| InChIKey | OYCDAEHDQVKOAD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |