C14H25N3 — CID 80775315
6-N-propan-2-yl-2-N,6-N-dipropylpyridine-2,6-diamine (PubChem CID 80775315) has the molecular formula C14H25N3 and a molecular weight of 235.38 g/mol. Its IUPAC name is 6-N-propan-2-yl-2-N,6-N-dipropylpyridine-2,6-diamine.
| Compound Name | 6-N-propan-2-yl-2-N,6-N-dipropylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80775315 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-N-propan-2-yl-2-N,6-N-dipropylpyridine-2,6-diamine |
| SMILES | CCCNc1cccc(N(CCC)C(C)C)n1 |
| InChI | InChI=1S/C14H25N3/c1-5-10-15-13-8-7-9-14(16-13)17(11-6-2)12(3)4/h7-9,12H,5-6,10-11H2,1-4H3,(H,15,16) |
| InChIKey | VXWIEKHVHOBXBA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |