About 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol
1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol (PubChem CID 80779109) has the molecular formula C14H24N4O
and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol.
Molecular Properties
| Compound Name | 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol |
| PubChem CID | 80779109 |
| Molecular Formula | C14H24N4O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol |
| SMILES | CCCNc1nc(C)nc(N2CCCC(O)C2)c1C |
| InChI | InChI=1S/C14H24N4O/c1-4-7-15-13-10(2)14(17-11(3)16-13)18-8-5-6-12(19)9-18/h12,19H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | OVQNTNRIVQKFDS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol?
The IUPAC name of 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol (CID 80779109) is 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol.
What is the SMILES notation for 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol?
The canonical SMILES for 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol is CCCNc1nc(C)nc(N2CCCC(O)C2)c1C.
What is the InChIKey of 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol?
The InChIKey is OVQNTNRIVQKFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4O/c1-4-7-15-13-10(2)14(17-11(3)16-13)18-8-5-6-12(19)9-18/h12,19H,4-9H2,1-3H3,(H,15,16,17).
What are the key properties of 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol?
1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol has a molecular weight of 264.37 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,5-dimethyl-6-(propylamino)pyrimidin-4-yl]piperidin-3-ol is sourced from PubChem (CID 80779109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).