C17H30N4 — CID 80823095
6-(4-ethylazepan-1-yl)-2,5-dimethyl-N-propylpyrimidin-4-amine (PubChem CID 80823095) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is 6-(4-ethylazepan-1-yl)-2,5-dimethyl-N-propylpyrimidin-4-amine.
| Compound Name | 6-(4-ethylazepan-1-yl)-2,5-dimethyl-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80823095 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 6-(4-ethylazepan-1-yl)-2,5-dimethyl-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C)nc(N2CCCC(CC)CC2)c1C |
| InChI | InChI=1S/C17H30N4/c1-5-10-18-16-13(3)17(20-14(4)19-16)21-11-7-8-15(6-2)9-12-21/h15H,5-12H2,1-4H3,(H,18,19,20) |
| InChIKey | DINOORZZPSGFTF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |