C14H25N7 — CID 80785173
2-N,2-N-diethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 80785173) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-N,2-N-diethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N-diethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80785173 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-N,2-N-diethyl-4-N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(NC2CCN3CCCC23)n1 |
| InChI | InChI=1S/C14H25N7/c1-3-20(4-2)14-18-12(15)17-13(19-14)16-10-7-9-21-8-5-6-11(10)21/h10-11H,3-9H2,1-2H3,(H3,15,16,17,18,19) |
| InChIKey | SIORQEJPIHYQRM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |