C12H22N6O2S — CID 81042433
4-N-[(1,1-dioxothiolan-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 81042433) has the molecular formula C12H22N6O2S and a molecular weight of 314.42 g/mol. Its IUPAC name is 4-N-[(1,1-dioxothiolan-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 81042433 |
| Molecular Formula | C12H22N6O2S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(NCC2CCCS2(=O)=O)n1 |
| InChI | InChI=1S/C12H22N6O2S/c1-3-18(4-2)12-16-10(13)15-11(17-12)14-8-9-6-5-7-21(9,19)20/h9H,3-8H2,1-2H3,(H3,13,14,15,16,17) |
| InChIKey | YITNUKDCGUWFJH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |