C8H15N5 — CID 80785316
4-N-butylpyrimidine-2,4,6-triamine (PubChem CID 80785316) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 4-N-butylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-butylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80785316 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 4-N-butylpyrimidine-2,4,6-triamine |
| SMILES | CCCCNc1cc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5/c1-2-3-4-11-7-5-6(9)12-8(10)13-7/h5H,2-4H2,1H3,(H5,9,10,11,12,13) |
| InChIKey | WNLAMKWLHKXPCT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|