C15H20N4O — CID 80787211
4-(2,5-dimethylmorpholin-4-yl)-N-methylquinazolin-2-amine (PubChem CID 80787211) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)-N-methylquinazolin-2-amine.
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)-N-methylquinazolin-2-amine |
|---|---|
| PubChem CID | 80787211 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)-N-methylquinazolin-2-amine |
| SMILES | CNc1nc(N2CC(C)OCC2C)c2ccccc2n1 |
| InChI | InChI=1S/C15H20N4O/c1-10-9-20-11(2)8-19(10)14-12-6-4-5-7-13(12)17-15(16-3)18-14/h4-7,10-11H,8-9H2,1-3H3,(H,16,17,18) |
| InChIKey | ZAOIRXJQMQHPBS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |