C13H20N6O — CID 80788012
N-[2-[[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]acetamide (PubChem CID 80788012) has the molecular formula C13H20N6O and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[2-[[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 80788012 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[2-[[6-(propylamino)imidazo[1,2-a]pyrazin-8-yl]amino]ethyl]acetamide |
| SMILES | CCCNc1cn2ccnc2c(NCCNC(C)=O)n1 |
| InChI | InChI=1S/C13H20N6O/c1-3-4-15-11-9-19-8-7-17-13(19)12(18-11)16-6-5-14-10(2)20/h7-9,15H,3-6H2,1-2H3,(H,14,20)(H,16,18) |
| InChIKey | YGXAAIDRSBPQAK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|