C9H15N5O — CID 80788095
2-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]propanamide (PubChem CID 80788095) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 2-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]propanamide.
| Compound Name | 2-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]propanamide |
|---|---|
| PubChem CID | 80788095 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-[(6-amino-2,5-dimethylpyrimidin-4-yl)amino]propanamide |
| SMILES | Cc1nc(N)c(C)c(NC(C)C(N)=O)n1 |
| InChI | InChI=1S/C9H15N5O/c1-4-7(10)13-6(3)14-9(4)12-5(2)8(11)15/h5H,1-3H3,(H2,11,15)(H3,10,12,13,14) |
| InChIKey | DKEFLDKKKOUJSO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |