C8H15N5O2S — CID 80788132
2-[[2-(ethylamino)pyrimidin-4-yl]amino]ethanesulfonamide (PubChem CID 80788132) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-[[2-(ethylamino)pyrimidin-4-yl]amino]ethanesulfonamide.
| Compound Name | 2-[[2-(ethylamino)pyrimidin-4-yl]amino]ethanesulfonamide |
|---|---|
| PubChem CID | 80788132 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[[2-(ethylamino)pyrimidin-4-yl]amino]ethanesulfonamide |
| SMILES | CCNc1nccc(NCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C8H15N5O2S/c1-2-10-8-12-4-3-7(13-8)11-5-6-16(9,14)15/h3-4H,2,5-6H2,1H3,(H2,9,14,15)(H2,10,11,12,13) |
| InChIKey | FGDMLGOLDGLFOF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |