C14H21N5O — CID 80789481
N-ethyl-8-(3-ethylmorpholin-4-yl)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80789481) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is N-ethyl-8-(3-ethylmorpholin-4-yl)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | N-ethyl-8-(3-ethylmorpholin-4-yl)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80789481 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-ethyl-8-(3-ethylmorpholin-4-yl)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCNc1cn2ccnc2c(N2CCOCC2CC)n1 |
| InChI | InChI=1S/C14H21N5O/c1-3-11-10-20-8-7-19(11)14-13-16-5-6-18(13)9-12(17-14)15-4-2/h5-6,9,11,15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | HOHQGOBNONAGIX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |