C11H19N5O — CID 80791929
4-(2-methylpyrrolidin-1-yl)-6-propoxy-1,3,5-triazin-2-amine (PubChem CID 80791929) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-yl)-6-propoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(2-methylpyrrolidin-1-yl)-6-propoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80791929 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-yl)-6-propoxy-1,3,5-triazin-2-amine |
| SMILES | CCCOc1nc(N)nc(N2CCCC2C)n1 |
| InChI | InChI=1S/C11H19N5O/c1-3-7-17-11-14-9(12)13-10(15-11)16-6-4-5-8(16)2/h8H,3-7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | WKFOPMKHOHJPNI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |