C15H22N4 — CID 80792804
2-N,4-N-dimethyl-4-N-pentan-3-ylquinazoline-2,4-diamine (PubChem CID 80792804) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-N,4-N-dimethyl-4-N-pentan-3-ylquinazoline-2,4-diamine.
| Compound Name | 2-N,4-N-dimethyl-4-N-pentan-3-ylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 80792804 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-N,4-N-dimethyl-4-N-pentan-3-ylquinazoline-2,4-diamine |
| SMILES | CCC(CC)N(C)c1nc(NC)nc2ccccc12 |
| InChI | InChI=1S/C15H22N4/c1-5-11(6-2)19(4)14-12-9-7-8-10-13(12)17-15(16-3)18-14/h7-11H,5-6H2,1-4H3,(H,16,17,18) |
| InChIKey | VZYNZARMAUEGSK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |