C15H19N5 — CID 80828170
3-[[2-(ethylamino)quinazolin-4-yl]-methylamino]butanenitrile (PubChem CID 80828170) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-[[2-(ethylamino)quinazolin-4-yl]-methylamino]butanenitrile.
| Compound Name | 3-[[2-(ethylamino)quinazolin-4-yl]-methylamino]butanenitrile |
|---|---|
| PubChem CID | 80828170 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 3-[[2-(ethylamino)quinazolin-4-yl]-methylamino]butanenitrile |
| SMILES | CCNc1nc(N(C)C(C)CC#N)c2ccccc2n1 |
| InChI | InChI=1S/C15H19N5/c1-4-17-15-18-13-8-6-5-7-12(13)14(19-15)20(3)11(2)9-10-16/h5-8,11H,4,9H2,1-3H3,(H,17,18,19) |
| InChIKey | BDBGOSHQVXCLJB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |