C12H22N6 — CID 80797993
2-N-(cyclopropylmethyl)-6-N-ethyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80797993) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-N-(cyclopropylmethyl)-6-N-ethyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(cyclopropylmethyl)-6-N-ethyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80797993 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-N-(cyclopropylmethyl)-6-N-ethyl-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCNc1nc(N(C)C)nc(N(C)CC2CC2)n1 |
| InChI | InChI=1S/C12H22N6/c1-5-13-10-14-11(17(2)3)16-12(15-10)18(4)8-9-6-7-9/h9H,5-8H2,1-4H3,(H,13,14,15,16) |
| InChIKey | GCGFHMCDFRMEKS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |