C13H20BrN5O — CID 80799994
2-[[5-bromo-2-(ethylamino)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone (PubChem CID 80799994) has the molecular formula C13H20BrN5O and a molecular weight of 342.24 g/mol. Its IUPAC name is 2-[[5-bromo-2-(ethylamino)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[[5-bromo-2-(ethylamino)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 80799994 |
| Molecular Formula | C13H20BrN5O |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 2-[[5-bromo-2-(ethylamino)pyrimidin-4-yl]-methylamino]-1-pyrrolidin-1-ylethanone |
| SMILES | CCNc1ncc(Br)c(N(C)CC(=O)N2CCCC2)n1 |
| InChI | InChI=1S/C13H20BrN5O/c1-3-15-13-16-8-10(14)12(17-13)18(2)9-11(20)19-6-4-5-7-19/h8H,3-7,9H2,1-2H3,(H,15,16,17) |
| InChIKey | RLUHKAQEKUSTDR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |