C13H24N6O2 — CID 80808783
4-N-(3-methoxypropyl)-2-N,4-N-dimethyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80808783) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-2-N,4-N-dimethyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(3-methoxypropyl)-2-N,4-N-dimethyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80808783 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-N-(3-methoxypropyl)-2-N,4-N-dimethyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CNc1nc(N(C)CCCOC)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H24N6O2/c1-14-11-15-12(18(2)5-4-8-20-3)17-13(16-11)19-6-9-21-10-7-19/h4-10H2,1-3H3,(H,14,15,16,17) |
| InChIKey | AORMMRILQNRUNX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|