C13H19N5S — CID 80810314
3-[cyclopropyl-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile (PubChem CID 80810314) has the molecular formula C13H19N5S and a molecular weight of 277.40 g/mol. Its IUPAC name is 3-[cyclopropyl-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile.
| Compound Name | 3-[cyclopropyl-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile |
|---|---|
| PubChem CID | 80810314 |
| Molecular Formula | C13H19N5S |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[cyclopropyl-[6-(ethylamino)-2-methylsulfanylpyrimidin-4-yl]amino]propanenitrile |
| SMILES | CCNc1cc(N(CCC#N)C2CC2)nc(SC)n1 |
| InChI | InChI=1S/C13H19N5S/c1-3-15-11-9-12(17-13(16-11)19-2)18(8-4-7-14)10-5-6-10/h9-10H,3-6,8H2,1-2H3,(H,15,16,17) |
| InChIKey | VZNWVGGADYOWBN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |